C24H26N4O3 — CID 108771284
N-[2-ethyl-5-[(6-methylpyrimidin-4-yl)amino]phenyl]-2-(2-prop-2-enoxyphenoxy)acetamide (PubChem CID 108771284) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[2-ethyl-5-[(6-methylpyrimidin-4-yl)amino]phenyl]-2-(2-prop-2-enoxyphenoxy)acetamide.
| Compound Name | N-[2-ethyl-5-[(6-methylpyrimidin-4-yl)amino]phenyl]-2-(2-prop-2-enoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 108771284 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-[2-ethyl-5-[(6-methylpyrimidin-4-yl)amino]phenyl]-2-(2-prop-2-enoxyphenoxy)acetamide |
| SMILES | C=CCOc1ccccc1OCC(=O)Nc1cc(Nc2cc(C)ncn2)ccc1CC |
| InChI | InChI=1S/C24H26N4O3/c1-4-12-30-21-8-6-7-9-22(21)31-15-24(29)28-20-14-19(11-10-18(20)5-2)27-23-13-17(3)25-16-26-23/h4,6-11,13-14,16H,1,5,12,15H2,2-3H3,(H,28,29)(H,25,26,27) |
| InChIKey | XSEUVKNCQKQZFA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|