C21H24N6O2S — CID 108787864
2-[4-[(4,6-dimethylpyrimidin-2-yl)amino]butanoylamino]-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 108787864) has the molecular formula C21H24N6O2S and a molecular weight of 424.53 g/mol. Its IUPAC name is 2-[4-[(4,6-dimethylpyrimidin-2-yl)amino]butanoylamino]-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[4-[(4,6-dimethylpyrimidin-2-yl)amino]butanoylamino]-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 108787864 |
| Molecular Formula | C21H24N6O2S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2-[4-[(4,6-dimethylpyrimidin-2-yl)amino]butanoylamino]-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cc(C)nc(NCCCC(=O)Nc2nc(C)c(C(=O)Nc3ccccc3)s2)n1 |
| InChI | InChI=1S/C21H24N6O2S/c1-13-12-14(2)24-20(23-13)22-11-7-10-17(28)27-21-25-15(3)18(30-21)19(29)26-16-8-5-4-6-9-16/h4-6,8-9,12H,7,10-11H2,1-3H3,(H,26,29)(H,22,23,24)(H,25,27,28) |
| InChIKey | LTEKMBHWNLURJV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|