C20H22ClN3O2S — CID 163329790
4-methyl-2-[2-(2-methylphenoxy)ethylamino]-N-phenyl-1,3-thiazole-5-carboxamide;hydrochloride (PubChem CID 163329790) has the molecular formula C20H22ClN3O2S and a molecular weight of 403.94 g/mol. Its IUPAC name is 4-methyl-2-[2-(2-methylphenoxy)ethylamino]-N-phenyl-1,3-thiazole-5-carboxamide;hydrochloride.
| Compound Name | 4-methyl-2-[2-(2-methylphenoxy)ethylamino]-N-phenyl-1,3-thiazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 163329790 |
| Molecular Formula | C20H22ClN3O2S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 4-methyl-2-[2-(2-methylphenoxy)ethylamino]-N-phenyl-1,3-thiazole-5-carboxamide;hydrochloride |
| SMILES | Cc1ccccc1OCCNc1nc(C)c(C(=O)Nc2ccccc2)s1.Cl |
| InChI | InChI=1S/C20H21N3O2S.ClH/c1-14-8-6-7-11-17(14)25-13-12-21-20-22-15(2)18(26-20)19(24)23-16-9-4-3-5-10-16;/h3-11H,12-13H2,1-2H3,(H,21,22)(H,23,24);1H |
| InChIKey | VNSDTLNHTPVHDO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|