C19H17N2O3S- — CID 9156219
4-methyl-2-[2-(2-phenylphenoxy)ethylamino]-1,3-thiazole-5-carboxylate (PubChem CID 9156219) has the molecular formula C19H17N2O3S- and a molecular weight of 353.42 g/mol. Its IUPAC name is 4-methyl-2-[2-(2-phenylphenoxy)ethylamino]-1,3-thiazole-5-carboxylate.
| Compound Name | 4-methyl-2-[2-(2-phenylphenoxy)ethylamino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 9156219 |
| Molecular Formula | C19H17N2O3S- |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 4-methyl-2-[2-(2-phenylphenoxy)ethylamino]-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(NCCOc2ccccc2-c2ccccc2)sc1C(=O)[O-] |
| InChI | InChI=1S/C19H18N2O3S/c1-13-17(18(22)23)25-19(21-13)20-11-12-24-16-10-6-5-9-15(16)14-7-3-2-4-8-14/h2-10H,11-12H2,1H3,(H,20,21)(H,22,23)/p-1 |
| InChIKey | NZWVKANUGYPENY-UHFFFAOYSA-M |
| XLogP | 2.97 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|