C13H13N2O4S- — CID 9149034
2-[(2-hydroxy-3-methoxyphenyl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 9149034) has the molecular formula C13H13N2O4S- and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-[(2-hydroxy-3-methoxyphenyl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | 2-[(2-hydroxy-3-methoxyphenyl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 9149034 |
| Molecular Formula | C13H13N2O4S- |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-[(2-hydroxy-3-methoxyphenyl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COc1cccc(CNc2nc(C)c(C(=O)[O-])s2)c1O |
| InChI | InChI=1S/C13H14N2O4S/c1-7-11(12(17)18)20-13(15-7)14-6-8-4-3-5-9(19-2)10(8)16/h3-5,16H,6H2,1-2H3,(H,14,15)(H,17,18)/p-1 |
| InChIKey | YJTCJGSPUFFQKY-UHFFFAOYSA-M |
| XLogP | 1.14 |
| TPSA | 94.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|