C18H23N2O3S- — CID 9156118
2-[2-(2-tert-butyl-5-methylphenoxy)ethylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 9156118) has the molecular formula C18H23N2O3S- and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[2-(2-tert-butyl-5-methylphenoxy)ethylamino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | 2-[2-(2-tert-butyl-5-methylphenoxy)ethylamino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 9156118 |
| Molecular Formula | C18H23N2O3S- |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-[2-(2-tert-butyl-5-methylphenoxy)ethylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1ccc(C(C)(C)C)c(OCCNc2nc(C)c(C(=O)[O-])s2)c1 |
| InChI | InChI=1S/C18H24N2O3S/c1-11-6-7-13(18(3,4)5)14(10-11)23-9-8-19-17-20-12(2)15(24-17)16(21)22/h6-7,10H,8-9H2,1-5H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | DRUSVIQKBGMSEB-UHFFFAOYSA-M |
| XLogP | 2.91 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|