C21H26O5 — CID 20988325
4-[2-(2-tert-butyl-5-methylphenoxy)ethoxy]-3-methoxybenzoic acid (PubChem CID 20988325) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is 4-[2-(2-tert-butyl-5-methylphenoxy)ethoxy]-3-methoxybenzoic acid.
| Compound Name | 4-[2-(2-tert-butyl-5-methylphenoxy)ethoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 20988325 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 4-[2-(2-tert-butyl-5-methylphenoxy)ethoxy]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1OCCOc1cc(C)ccc1C(C)(C)C |
| InChI | InChI=1S/C21H26O5/c1-14-6-8-16(21(2,3)4)18(12-14)26-11-10-25-17-9-7-15(20(22)23)13-19(17)24-5/h6-9,12-13H,10-11H2,1-5H3,(H,22,23) |
| InChIKey | NLTJBNXRHRTZKW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|