C21H24O8 — CID 121440196
4-[3-(4-carboxy-2-methoxyphenoxy)-3-methylbutoxy]-3-methoxybenzoic acid (PubChem CID 121440196) has the molecular formula C21H24O8 and a molecular weight of 404.42 g/mol. Its IUPAC name is 4-[3-(4-carboxy-2-methoxyphenoxy)-3-methylbutoxy]-3-methoxybenzoic acid.
| Compound Name | 4-[3-(4-carboxy-2-methoxyphenoxy)-3-methylbutoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 121440196 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-[3-(4-carboxy-2-methoxyphenoxy)-3-methylbutoxy]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1OCCC(C)(C)Oc1ccc(C(=O)O)cc1OC |
| InChI | InChI=1S/C21H24O8/c1-21(2,29-16-8-6-14(20(24)25)12-18(16)27-4)9-10-28-15-7-5-13(19(22)23)11-17(15)26-3/h5-8,11-12H,9-10H2,1-4H3,(H,22,23)(H,24,25) |
| InChIKey | BZYFJUXCZHCDBM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |