C22H28O6 — CID 20988478
4-[2-(2-tert-butyl-4-methoxyphenoxy)ethoxy]-3-ethoxybenzoic acid (PubChem CID 20988478) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is 4-[2-(2-tert-butyl-4-methoxyphenoxy)ethoxy]-3-ethoxybenzoic acid.
| Compound Name | 4-[2-(2-tert-butyl-4-methoxyphenoxy)ethoxy]-3-ethoxybenzoic acid |
|---|---|
| PubChem CID | 20988478 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 4-[2-(2-tert-butyl-4-methoxyphenoxy)ethoxy]-3-ethoxybenzoic acid |
| SMILES | CCOc1cc(C(=O)O)ccc1OCCOc1ccc(OC)cc1C(C)(C)C |
| InChI | InChI=1S/C22H28O6/c1-6-26-20-13-15(21(23)24)7-9-19(20)28-12-11-27-18-10-8-16(25-5)14-17(18)22(2,3)4/h7-10,13-14H,6,11-12H2,1-5H3,(H,23,24) |
| InChIKey | NRWWFNHVYMASHO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|