C20H24O5 — CID 22683537
3-[2-(4-tert-butylphenoxy)ethoxy]-4-methoxybenzoic acid (PubChem CID 22683537) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-[2-(4-tert-butylphenoxy)ethoxy]-4-methoxybenzoic acid.
| Compound Name | 3-[2-(4-tert-butylphenoxy)ethoxy]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 22683537 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 3-[2-(4-tert-butylphenoxy)ethoxy]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1OCCOc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H24O5/c1-20(2,3)15-6-8-16(9-7-15)24-11-12-25-18-13-14(19(21)22)5-10-17(18)23-4/h5-10,13H,11-12H2,1-4H3,(H,21,22) |
| InChIKey | VRJCJZFBEWTJQW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|