C18H21N5O3S2 — CID 108787890
4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)butanamide (PubChem CID 108787890) has the molecular formula C18H21N5O3S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 108787890 |
| Molecular Formula | C18H21N5O3S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)butanamide |
| SMILES | Cc1cc(C)nc(NCCCC(=O)Nc2nc3ccc(S(C)(=O)=O)cc3s2)n1 |
| InChI | InChI=1S/C18H21N5O3S2/c1-11-9-12(2)21-17(20-11)19-8-4-5-16(24)23-18-22-14-7-6-13(28(3,25)26)10-15(14)27-18/h6-7,9-10H,4-5,8H2,1-3H3,(H,19,20,21)(H,22,23,24) |
| InChIKey | XOCMJEQXRQVNQX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|