C17H22N2O3S2 — CID 1222303
3-cyclohexyl-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)propanamide (PubChem CID 1222303) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 3-cyclohexyl-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 3-cyclohexyl-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 1222303 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 3-cyclohexyl-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)propanamide |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=O)CCC3CCCCC3)sc2c1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-24(21,22)13-8-9-14-15(11-13)23-17(18-14)19-16(20)10-7-12-5-3-2-4-6-12/h8-9,11-12H,2-7,10H2,1H3,(H,18,19,20) |
| InChIKey | PBPYYCYUWIUOAZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |