C18H23N3O7S2 — CID 171668780
2-(4-methylpiperidin-1-yl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)acetamide;oxalic acid (PubChem CID 171668780) has the molecular formula C18H23N3O7S2 and a molecular weight of 457.53 g/mol. Its IUPAC name is 2-(4-methylpiperidin-1-yl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)acetamide;oxalic acid.
| Compound Name | 2-(4-methylpiperidin-1-yl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)acetamide;oxalic acid |
|---|---|
| PubChem CID | 171668780 |
| Molecular Formula | C18H23N3O7S2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 2-(4-methylpiperidin-1-yl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)acetamide;oxalic acid |
| SMILES | CC1CCN(CC(=O)Nc2nc3ccc(S(C)(=O)=O)cc3s2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H21N3O3S2.C2H2O4/c1-11-5-7-19(8-6-11)10-15(20)18-16-17-13-4-3-12(24(2,21)22)9-14(13)23-16;3-1(4)2(5)6/h3-4,9,11H,5-8,10H2,1-2H3,(H,17,18,20);(H,3,4)(H,5,6) |
| InChIKey | WXZYGJKYGVSNSN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 153.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|