C20H24N4O5S2 — CID 55335075
2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)acetamide (PubChem CID 55335075) has the molecular formula C20H24N4O5S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 55335075 |
| Molecular Formula | C20H24N4O5S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)Nc1nc3ccc(S(C)(=O)=O)cc3s1)C2=O |
| InChI | InChI=1S/C20H24N4O5S2/c1-3-12-6-8-20(9-7-12)17(26)24(19(27)23-20)11-16(25)22-18-21-14-5-4-13(31(2,28)29)10-15(14)30-18/h4-5,10,12H,3,6-9,11H2,1-2H3,(H,23,27)(H,21,22,25) |
| InChIKey | YQBIIPNXKWXWFX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|