C21H24N4O3S — CID 86979365
2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 86979365) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 86979365 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)Nc1ncc(-c3ccccc3)s1)C2=O |
| InChI | InChI=1S/C21H24N4O3S/c1-2-14-8-10-21(11-9-14)18(27)25(20(28)24-21)13-17(26)23-19-22-12-16(29-19)15-6-4-3-5-7-15/h3-7,12,14H,2,8-11,13H2,1H3,(H,24,28)(H,22,23,26) |
| InChIKey | OKNOKZGEZCFNAX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|