C22H30N4O4 — CID 55304263
N-(2,6-dimethylphenyl)-2-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]acetamide (PubChem CID 55304263) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 55304263 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]acetamide |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)NCC(=O)Nc1c(C)cccc1C)C2=O |
| InChI | InChI=1S/C22H30N4O4/c1-4-16-8-10-22(11-9-16)20(29)26(21(30)25-22)13-18(28)23-12-17(27)24-19-14(2)6-5-7-15(19)3/h5-7,16H,4,8-13H2,1-3H3,(H,23,28)(H,24,27)(H,25,30) |
| InChIKey | CCPFVRIQQITLGG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|