C20H25N3O5 — CID 119346035
4-[[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]methyl]benzoic acid (PubChem CID 119346035) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 4-[[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 119346035 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 4-[[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]methyl]benzoic acid |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccc(C(=O)O)cc1)C2=O |
| InChI | InChI=1S/C20H25N3O5/c1-2-13-7-9-20(10-8-13)18(27)23(19(28)22-20)12-16(24)21-11-14-3-5-15(6-4-14)17(25)26/h3-6,13H,2,7-12H2,1H3,(H,21,24)(H,22,28)(H,25,26) |
| InChIKey | MNRDOMRRKZFHJY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|