C21H34N4O4 — CID 55968177
N-ethyl-1-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]cyclohexane-1-carboxamide (PubChem CID 55968177) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-ethyl-1-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]cyclohexane-1-carboxamide.
| Compound Name | N-ethyl-1-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 55968177 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | N-ethyl-1-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]cyclohexane-1-carboxamide |
| SMILES | CCNC(=O)C1(NC(=O)CN2C(=O)NC3(CCC(CC)CC3)C2=O)CCCCC1 |
| InChI | InChI=1S/C21H34N4O4/c1-3-15-8-12-21(13-9-15)18(28)25(19(29)24-21)14-16(26)23-20(17(27)22-4-2)10-6-5-7-11-20/h15H,3-14H2,1-2H3,(H,22,27)(H,23,26)(H,24,29) |
| InChIKey | WDBZYBFMIHZWEP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|