C21H30N4O5S — CID 55460877
2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[[4-(methylsulfamoylmethyl)phenyl]methyl]acetamide (PubChem CID 55460877) has the molecular formula C21H30N4O5S and a molecular weight of 450.56 g/mol. Its IUPAC name is 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[[4-(methylsulfamoylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[[4-(methylsulfamoylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55460877 |
| Molecular Formula | C21H30N4O5S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[[4-(methylsulfamoylmethyl)phenyl]methyl]acetamide |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccc(CS(=O)(=O)NC)cc1)C2=O |
| InChI | InChI=1S/C21H30N4O5S/c1-3-15-8-10-21(11-9-15)19(27)25(20(28)24-21)13-18(26)23-12-16-4-6-17(7-5-16)14-31(29,30)22-2/h4-7,15,22H,3,8-14H2,1-2H3,(H,23,26)(H,24,28) |
| InChIKey | FWPYCXFVWGFSHG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|