C18H23N5O3S — CID 55585898
2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide (PubChem CID 55585898) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide.
| Compound Name | 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide |
|---|---|
| PubChem CID | 55585898 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)acetamide |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)NCc1cn3ccsc3n1)C2=O |
| InChI | InChI=1S/C18H23N5O3S/c1-2-12-3-5-18(6-4-12)15(25)23(16(26)21-18)11-14(24)19-9-13-10-22-7-8-27-17(22)20-13/h7-8,10,12H,2-6,9,11H2,1H3,(H,19,24)(H,21,26) |
| InChIKey | WZUZIYORQFEYSC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|