C21H28N4O5 — CID 55869488
N-[2-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]ethyl]-4-hydroxybenzamide (PubChem CID 55869488) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[2-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]ethyl]-4-hydroxybenzamide.
| Compound Name | N-[2-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]ethyl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 55869488 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-[2-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]ethyl]-4-hydroxybenzamide |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)NCCNC(=O)c1ccc(O)cc1)C2=O |
| InChI | InChI=1S/C21H28N4O5/c1-2-14-7-9-21(10-8-14)19(29)25(20(30)24-21)13-17(27)22-11-12-23-18(28)15-3-5-16(26)6-4-15/h3-6,14,26H,2,7-13H2,1H3,(H,22,27)(H,23,28)(H,24,30) |
| InChIKey | COAZZFZYFJXTBA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|