C24H33N3O4 — CID 7180897
N-[4-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]phenyl]hexanamide (PubChem CID 7180897) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-[4-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]phenyl]hexanamide.
| Compound Name | N-[4-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 7180897 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | N-[4-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(C(=O)CN2C(=O)NC3(CCC(CC)CC3)C2=O)cc1 |
| InChI | InChI=1S/C24H33N3O4/c1-3-5-6-7-21(29)25-19-10-8-18(9-11-19)20(28)16-27-22(30)24(26-23(27)31)14-12-17(4-2)13-15-24/h8-11,17H,3-7,12-16H2,1-2H3,(H,25,29)(H,26,31) |
| InChIKey | YGWIDELDKKYZGZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|