C22H27N3O7 — CID 2443504
dimethyl 5-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 2443504) has the molecular formula C22H27N3O7 and a molecular weight of 445.47 g/mol. Its IUPAC name is dimethyl 5-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2443504 |
| Molecular Formula | C22H27N3O7 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | dimethyl 5-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)Nc1cc(C(=O)OC)cc(C(=O)OC)c1)C2=O |
| InChI | InChI=1S/C22H27N3O7/c1-4-13-5-7-22(8-6-13)20(29)25(21(30)24-22)12-17(26)23-16-10-14(18(27)31-2)9-15(11-16)19(28)32-3/h9-11,13H,4-8,12H2,1-3H3,(H,23,26)(H,24,30) |
| InChIKey | KPXZIYTZLRIAFE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|