C19H22ClN3O5 — CID 55556134
methyl 2-chloro-5-[[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]benzoate (PubChem CID 55556134) has the molecular formula C19H22ClN3O5 and a molecular weight of 407.85 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 55556134 |
| Molecular Formula | C19H22ClN3O5 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | methyl 2-chloro-5-[[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)CN2C(=O)NC3(CCC(C)CC3)C2=O)ccc1Cl |
| InChI | InChI=1S/C19H22ClN3O5/c1-11-5-7-19(8-6-11)17(26)23(18(27)22-19)10-15(24)21-12-3-4-14(20)13(9-12)16(25)28-2/h3-4,9,11H,5-8,10H2,1-2H3,(H,21,24)(H,22,27) |
| InChIKey | XDHZIFNZIISMRZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|