C20H25N5O3 — CID 136579576
N-(1-ethylindazol-6-yl)-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 136579576) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-(1-ethylindazol-6-yl)-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-(1-ethylindazol-6-yl)-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 136579576 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-(1-ethylindazol-6-yl)-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CCn1ncc2ccc(NC(=O)CN3C(=O)NC4(CCC(C)CC4)C3=O)cc21 |
| InChI | InChI=1S/C20H25N5O3/c1-3-25-16-10-15(5-4-14(16)11-21-25)22-17(26)12-24-18(27)20(23-19(24)28)8-6-13(2)7-9-20/h4-5,10-11,13H,3,6-9,12H2,1-2H3,(H,22,26)(H,23,28) |
| InChIKey | HQLPENNYKAKGBU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|