C22H24N4O4S — CID 55510760
N-[3-[[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]phenyl]thiophene-2-carboxamide (PubChem CID 55510760) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is N-[3-[[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55510760 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-[3-[[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]phenyl]thiophene-2-carboxamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(CC(=O)Nc1cccc(NC(=O)c3cccs3)c1)C2=O |
| InChI | InChI=1S/C22H24N4O4S/c1-14-7-9-22(10-8-14)20(29)26(21(30)25-22)13-18(27)23-15-4-2-5-16(12-15)24-19(28)17-6-3-11-31-17/h2-6,11-12,14H,7-10,13H2,1H3,(H,23,27)(H,24,28)(H,25,30) |
| InChIKey | XEZRHPOKZMZXPL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|