C24H27N5O4 — CID 55903583
N-[3-[[[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]methyl]phenyl]pyridine-4-carboxamide (PubChem CID 55903583) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-[3-[[[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]methyl]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[[[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]methyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55903583 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | N-[3-[[[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]methyl]phenyl]pyridine-4-carboxamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(CC(=O)NCc1cccc(NC(=O)c3ccncc3)c1)C2=O |
| InChI | InChI=1S/C24H27N5O4/c1-16-5-9-24(10-6-16)22(32)29(23(33)28-24)15-20(30)26-14-17-3-2-4-19(13-17)27-21(31)18-7-11-25-12-8-18/h2-4,7-8,11-13,16H,5-6,9-10,14-15H2,1H3,(H,26,30)(H,27,31)(H,28,33) |
| InChIKey | WUVDBWVBYZTENV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|