C24H25N3O4 — CID 7630356
N-[4-[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]phenyl]benzamide (PubChem CID 7630356) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-[4-[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]phenyl]benzamide.
| Compound Name | N-[4-[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]phenyl]benzamide |
|---|---|
| PubChem CID | 7630356 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-[4-[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]phenyl]benzamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(CC(=O)c1ccc(NC(=O)c3ccccc3)cc1)C2=O |
| InChI | InChI=1S/C24H25N3O4/c1-16-11-13-24(14-12-16)22(30)27(23(31)26-24)15-20(28)17-7-9-19(10-8-17)25-21(29)18-5-3-2-4-6-18/h2-10,16H,11-15H2,1H3,(H,25,29)(H,26,31) |
| InChIKey | NMTQRFJVQFYGNV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|