C18H21ClN4O4 — CID 46523058
4-chloro-N'-[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]benzohydrazide (PubChem CID 46523058) has the molecular formula C18H21ClN4O4 and a molecular weight of 392.84 g/mol. Its IUPAC name is 4-chloro-N'-[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 46523058 |
| Molecular Formula | C18H21ClN4O4 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 4-chloro-N'-[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]benzohydrazide |
| SMILES | CC1CCC2(CC1)NC(=O)N(CC(=O)NNC(=O)c1ccc(Cl)cc1)C2=O |
| InChI | InChI=1S/C18H21ClN4O4/c1-11-6-8-18(9-7-11)16(26)23(17(27)20-18)10-14(24)21-22-15(25)12-2-4-13(19)5-3-12/h2-5,11H,6-10H2,1H3,(H,20,27)(H,21,24)(H,22,25) |
| InChIKey | IOBILNQLILQELP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|