C22H29ClN4O4 — CID 36855688
N'-[2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-2-(4-chlorophenyl)acetohydrazide (PubChem CID 36855688) has the molecular formula C22H29ClN4O4 and a molecular weight of 448.95 g/mol. Its IUPAC name is N'-[2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-2-(4-chlorophenyl)acetohydrazide.
| Compound Name | N'-[2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-2-(4-chlorophenyl)acetohydrazide |
|---|---|
| PubChem CID | 36855688 |
| Molecular Formula | C22H29ClN4O4 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | N'-[2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-2-(4-chlorophenyl)acetohydrazide |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)N(CC(=O)NNC(=O)Cc1ccc(Cl)cc1)C2=O |
| InChI | InChI=1S/C22H29ClN4O4/c1-21(2,3)15-8-10-22(11-9-15)19(30)27(20(31)24-22)13-18(29)26-25-17(28)12-14-4-6-16(23)7-5-14/h4-7,15H,8-13H2,1-3H3,(H,24,31)(H,25,28)(H,26,29) |
| InChIKey | JXLIBOYKTVALPI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|