C20H25Cl3N4O3 — CID 36715165
2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N'-(2,4,6-trichlorophenyl)acetohydrazide (PubChem CID 36715165) has the molecular formula C20H25Cl3N4O3 and a molecular weight of 475.80 g/mol. Its IUPAC name is 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N'-(2,4,6-trichlorophenyl)acetohydrazide.
| Compound Name | 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N'-(2,4,6-trichlorophenyl)acetohydrazide |
|---|---|
| PubChem CID | 36715165 |
| Molecular Formula | C20H25Cl3N4O3 |
| Molecular Weight | 475.80 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N'-(2,4,6-trichlorophenyl)acetohydrazide |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)N(CC(=O)NNc1c(Cl)cc(Cl)cc1Cl)C2=O |
| InChI | InChI=1S/C20H25Cl3N4O3/c1-19(2,3)11-4-6-20(7-5-11)17(29)27(18(30)24-20)10-15(28)25-26-16-13(22)8-12(21)9-14(16)23/h8-9,11,26H,4-7,10H2,1-3H3,(H,24,30)(H,25,28) |
| InChIKey | NZIPQVPSLQPVAN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.80 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|