C20H28N4O3 — CID 36714303
2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 36714303) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 36714303 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccccn1)C2=O |
| InChI | InChI=1S/C20H28N4O3/c1-19(2,3)14-7-9-20(10-8-14)17(26)24(18(27)23-20)13-16(25)22-12-15-6-4-5-11-21-15/h4-6,11,14H,7-10,12-13H2,1-3H3,(H,22,25)(H,23,27) |
| InChIKey | KDJZOLQDSBMPDD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|