C25H35N5O4 — CID 55970040
1-[2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-N-pyridin-2-ylpiperidine-4-carboxamide (PubChem CID 55970040) has the molecular formula C25H35N5O4 and a molecular weight of 469.59 g/mol. Its IUPAC name is 1-[2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-N-pyridin-2-ylpiperidine-4-carboxamide.
| Compound Name | 1-[2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-N-pyridin-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55970040 |
| Molecular Formula | C25H35N5O4 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 1-[2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-N-pyridin-2-ylpiperidine-4-carboxamide |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)N(CC(=O)N1CCC(C(=O)Nc3ccccn3)CC1)C2=O |
| InChI | InChI=1S/C25H35N5O4/c1-24(2,3)18-7-11-25(12-8-18)22(33)30(23(34)28-25)16-20(31)29-14-9-17(10-15-29)21(32)27-19-6-4-5-13-26-19/h4-6,13,17-18H,7-12,14-16H2,1-3H3,(H,28,34)(H,26,27,32) |
| InChIKey | AYCCWELEOTVULU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|