C21H36N4O3 — CID 120820292
3-[2-(4-amino-3,3-dimethylpiperidin-1-yl)-2-oxoethyl]-8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 120820292) has the molecular formula C21H36N4O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is 3-[2-(4-amino-3,3-dimethylpiperidin-1-yl)-2-oxoethyl]-8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-(4-amino-3,3-dimethylpiperidin-1-yl)-2-oxoethyl]-8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 120820292 |
| Molecular Formula | C21H36N4O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | 3-[2-(4-amino-3,3-dimethylpiperidin-1-yl)-2-oxoethyl]-8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)N(CC(=O)N1CCC(N)C(C)(C)C1)C2=O |
| InChI | InChI=1S/C21H36N4O3/c1-19(2,3)14-6-9-21(10-7-14)17(27)25(18(28)23-21)12-16(26)24-11-8-15(22)20(4,5)13-24/h14-15H,6-13,22H2,1-5H3,(H,23,28) |
| InChIKey | ATVUXXVYEFPSLD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|