C17H24N4O3 — CID 49063313
1-[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperidine-4-carbonitrile (PubChem CID 49063313) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperidine-4-carbonitrile.
| Compound Name | 1-[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 49063313 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperidine-4-carbonitrile |
| SMILES | CC1CCC2(CC1)NC(=O)N(CC(=O)N1CCC(C#N)CC1)C2=O |
| InChI | InChI=1S/C17H24N4O3/c1-12-2-6-17(7-3-12)15(23)21(16(24)19-17)11-14(22)20-8-4-13(10-18)5-9-20/h12-13H,2-9,11H2,1H3,(H,19,24) |
| InChIKey | BQGRWCHZLMMFDV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|