C18H28N4O4 — CID 9474385
1-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperidine-4-carboxamide (PubChem CID 9474385) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9474385 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 1-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperidine-4-carboxamide |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)N1CCC(C(N)=O)CC1)C2=O |
| InChI | InChI=1S/C18H28N4O4/c1-2-12-3-7-18(8-4-12)16(25)22(17(26)20-18)11-14(23)21-9-5-13(6-10-21)15(19)24/h12-13H,2-11H2,1H3,(H2,19,24)(H,20,26) |
| InChIKey | PFRISCWWGHIHAG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|