C18H29ClN4O3 — CID 120659911
3-[2-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-8-ethyl-1,3-diazaspiro[4.5]decane-2,4-dione;hydrochloride (PubChem CID 120659911) has the molecular formula C18H29ClN4O3 and a molecular weight of 384.91 g/mol. Its IUPAC name is 3-[2-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-8-ethyl-1,3-diazaspiro[4.5]decane-2,4-dione;hydrochloride.
| Compound Name | 3-[2-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-8-ethyl-1,3-diazaspiro[4.5]decane-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 120659911 |
| Molecular Formula | C18H29ClN4O3 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 3-[2-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-8-ethyl-1,3-diazaspiro[4.5]decane-2,4-dione;hydrochloride |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)N1C[C@H]3CNC[C@H]3C1)C2=O.Cl |
| InChI | InChI=1S/C18H28N4O3.ClH/c1-2-12-3-5-18(6-4-12)16(24)22(17(25)20-18)11-15(23)21-9-13-7-19-8-14(13)10-21;/h12-14,19H,2-11H2,1H3,(H,20,25);1H/t12?,13-,14+,18?; |
| InChIKey | VNAVMGKLAXBPGS-MHRDXIBRSA-N |
| XLogP | 0.98 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|