C17H25N3O5 — CID 7609865
methyl 1-[2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperidine-4-carboxylate (PubChem CID 7609865) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is methyl 1-[2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7609865 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | methyl 1-[2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CN2C(=O)NC3(CCCCC3)C2=O)CC1 |
| InChI | InChI=1S/C17H25N3O5/c1-25-14(22)12-5-9-19(10-6-12)13(21)11-20-15(23)17(18-16(20)24)7-3-2-4-8-17/h12H,2-11H2,1H3,(H,18,24) |
| InChIKey | BQKCMNMWUXUPAJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|