C22H29N3O5 — CID 55326849
methyl 1-[2-(4-butyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]piperidine-4-carboxylate (PubChem CID 55326849) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is methyl 1-[2-(4-butyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-(4-butyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55326849 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | methyl 1-[2-(4-butyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]piperidine-4-carboxylate |
| SMILES | CCCCC1(c2ccccc2)NC(=O)N(CC(=O)N2CCC(C(=O)OC)CC2)C1=O |
| InChI | InChI=1S/C22H29N3O5/c1-3-4-12-22(17-8-6-5-7-9-17)20(28)25(21(29)23-22)15-18(26)24-13-10-16(11-14-24)19(27)30-2/h5-9,16H,3-4,10-15H2,1-2H3,(H,23,29) |
| InChIKey | TUUOGAOQRQQDGW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|