C27H38N4O4 — CID 33100935
N-benzyl-1-[2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperidine-4-carboxamide (PubChem CID 33100935) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is N-benzyl-1-[2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 33100935 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | N-benzyl-1-[2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperidine-4-carboxamide |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)N(CC(=O)N1CCC(C(=O)NCc3ccccc3)CC1)C2=O |
| InChI | InChI=1S/C27H38N4O4/c1-26(2,3)21-9-13-27(14-10-21)24(34)31(25(35)29-27)18-22(32)30-15-11-20(12-16-30)23(33)28-17-19-7-5-4-6-8-19/h4-8,20-21H,9-18H2,1-3H3,(H,28,33)(H,29,35) |
| InChIKey | PEJNWXMMXOOZKA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|