C24H33N3O3 — CID 34457472
N-benzyl-2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-cyclopropylacetamide (PubChem CID 34457472) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-benzyl-2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-cyclopropylacetamide.
| Compound Name | N-benzyl-2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 34457472 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | N-benzyl-2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-cyclopropylacetamide |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)N(CC(=O)N(Cc1ccccc1)C1CC1)C2=O |
| InChI | InChI=1S/C24H33N3O3/c1-23(2,3)18-11-13-24(14-12-18)21(29)27(22(30)25-24)16-20(28)26(19-9-10-19)15-17-7-5-4-6-8-17/h4-8,18-19H,9-16H2,1-3H3,(H,25,30) |
| InChIKey | HBMMHOUBEQDXTL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|