C21H35N3O2 — CID 31979321
8-tert-butyl-3-[[cyclopentyl(cyclopropyl)amino]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 31979321) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is 8-tert-butyl-3-[[cyclopentyl(cyclopropyl)amino]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-tert-butyl-3-[[cyclopentyl(cyclopropyl)amino]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 31979321 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | 8-tert-butyl-3-[[cyclopentyl(cyclopropyl)amino]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)N(CN(C1CCCC1)C1CC1)C2=O |
| InChI | InChI=1S/C21H35N3O2/c1-20(2,3)15-10-12-21(13-11-15)18(25)24(19(26)22-21)14-23(17-8-9-17)16-6-4-5-7-16/h15-17H,4-14H2,1-3H3,(H,22,26) |
| InChIKey | MWKSPBWNVBVQHZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|