C18H23N3O3 — CID 2701791
2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-methyl-N-phenylacetamide (PubChem CID 2701791) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-methyl-N-phenylacetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-methyl-N-phenylacetamide |
|---|---|
| PubChem CID | 2701791 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-methyl-N-phenylacetamide |
| SMILES | CN(C(=O)CN1C(=O)NC2(CCCCCC2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C18H23N3O3/c1-20(14-9-5-4-6-10-14)15(22)13-21-16(23)18(19-17(21)24)11-7-2-3-8-12-18/h4-6,9-10H,2-3,7-8,11-13H2,1H3,(H,19,24) |
| InChIKey | ZSEZUJBQEMZEPO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|