C22H30N4O4 — CID 2578515
2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylacetamide (PubChem CID 2578515) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylacetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 2578515 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylacetamide |
| SMILES | CCc1ccccc1NC(=O)CN(C)C(=O)CN1C(=O)NC2(CCCCCC2)C1=O |
| InChI | InChI=1S/C22H30N4O4/c1-3-16-10-6-7-11-17(16)23-18(27)14-25(2)19(28)15-26-20(29)22(24-21(26)30)12-8-4-5-9-13-22/h6-7,10-11H,3-5,8-9,12-15H2,1-2H3,(H,23,27)(H,24,30) |
| InChIKey | HMHZXZYBWCKSIC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|