C19H21N5O3 — CID 55643149
2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[2-(pyrazol-1-ylmethyl)phenyl]acetamide (PubChem CID 55643149) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[2-(pyrazol-1-ylmethyl)phenyl]acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[2-(pyrazol-1-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55643149 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[2-(pyrazol-1-ylmethyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCC2)C1=O)Nc1ccccc1Cn1cccn1 |
| InChI | InChI=1S/C19H21N5O3/c25-16(13-24-17(26)19(22-18(24)27)8-3-4-9-19)21-15-7-2-1-6-14(15)12-23-11-5-10-20-23/h1-2,5-7,10-11H,3-4,8-9,12-13H2,(H,21,25)(H,22,27) |
| InChIKey | MHWLXUHZMNOKEY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|