C21H25N5O3 — CID 43068795
2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-(pyrazol-1-ylmethyl)phenyl]acetamide (PubChem CID 43068795) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-(pyrazol-1-ylmethyl)phenyl]acetamide.
| Compound Name | 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-(pyrazol-1-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 43068795 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-(pyrazol-1-ylmethyl)phenyl]acetamide |
| SMILES | CN1C(=O)N(CC(=O)Nc2ccccc2Cn2cccn2)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C21H25N5O3/c1-24-20(29)26(19(28)21(24)10-5-2-6-11-21)15-18(27)23-17-9-4-3-8-16(17)14-25-13-7-12-22-25/h3-4,7-9,12-13H,2,5-6,10-11,14-15H2,1H3,(H,23,27) |
| InChIKey | ZKWYYWLXQBKSSV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|