C23H25N3O3 — CID 7850067
2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(4-phenylphenyl)acetamide (PubChem CID 7850067) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(4-phenylphenyl)acetamide.
| Compound Name | 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 7850067 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(4-phenylphenyl)acetamide |
| SMILES | CN1C(=O)N(CC(=O)Nc2ccc(-c3ccccc3)cc2)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C23H25N3O3/c1-25-22(29)26(21(28)23(25)14-6-3-7-15-23)16-20(27)24-19-12-10-18(11-13-19)17-8-4-2-5-9-17/h2,4-5,8-13H,3,6-7,14-16H2,1H3,(H,24,27) |
| InChIKey | JNWADSULIJANHV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|