C18H20F3N3O3 — CID 4793877
2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 4793877) has the molecular formula C18H20F3N3O3 and a molecular weight of 383.37 g/mol. Its IUPAC name is 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4793877 |
| Molecular Formula | C18H20F3N3O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CN1C(=O)N(CC(=O)Nc2ccc(C(F)(F)F)cc2)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C18H20F3N3O3/c1-23-16(27)24(15(26)17(23)9-3-2-4-10-17)11-14(25)22-13-7-5-12(6-8-13)18(19,20)21/h5-8H,2-4,9-11H2,1H3,(H,22,25) |
| InChIKey | JDINXPMWGNIFGN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|