C17H18F3N3O3 — CID 56761630
2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(3,4,5-trifluorophenyl)acetamide (PubChem CID 56761630) has the molecular formula C17H18F3N3O3 and a molecular weight of 369.34 g/mol. Its IUPAC name is 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(3,4,5-trifluorophenyl)acetamide.
| Compound Name | 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(3,4,5-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 56761630 |
| Molecular Formula | C17H18F3N3O3 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(3,4,5-trifluorophenyl)acetamide |
| SMILES | CN1C(=O)N(CC(=O)Nc2cc(F)c(F)c(F)c2)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C17H18F3N3O3/c1-22-16(26)23(15(25)17(22)5-3-2-4-6-17)9-13(24)21-10-7-11(18)14(20)12(19)8-10/h7-8H,2-6,9H2,1H3,(H,21,24) |
| InChIKey | NODNIXAYJFNMNE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|