C17H19Cl2N3O3 — CID 7850278
N-(3,5-dichlorophenyl)-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 7850278) has the molecular formula C17H19Cl2N3O3 and a molecular weight of 384.26 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 7850278 |
| Molecular Formula | C17H19Cl2N3O3 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CN1C(=O)N(CC(=O)Nc2cc(Cl)cc(Cl)c2)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C17H19Cl2N3O3/c1-21-16(25)22(15(24)17(21)5-3-2-4-6-17)10-14(23)20-13-8-11(18)7-12(19)9-13/h7-9H,2-6,10H2,1H3,(H,20,23) |
| InChIKey | TZVOGCMTGQJWFZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|